CAS 2756104-05-7 is the registry number for tert-Butyldimethyl{[(1r,4r)-4-ethynylcyclohexyl]oxy}silane, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
Tert-butyl-(4-ethynylcyclohexyl)oxy-dimethylsilane (CAS 2756104-05-7) is a chemical compound with the molecular formula C14H26OSi and a molecular weight of 238.44 g/mol. IUPAC name: tert-butyl-(4-ethynylcyclohexyl)oxy-dimethylsilane. InChIKey: ALAOUJNKJVASKF-UHFFFAOYSA-N.
| Molecular formula | C14H26OSi |
|---|---|
| Molecular weight | 238.44 g/mol |
| IUPAC name | tert-butyl-(4-ethynylcyclohexyl)oxy-dimethylsilane |
| InChIKey | ALAOUJNKJVASKF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CC1)C#C |
Computed by PubChem (NCBI)