CAS 21325-03-1 is the registry number for 4-Fluoro-2-nitrophenylthiocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
(4-fluoro-2-nitrophenyl) thiocyanate (CAS 21325-03-1) is a chemical compound with the molecular formula C7H3FN2O2S and a molecular weight of 198.18 g/mol. IUPAC name: (4-fluoro-2-nitrophenyl) thiocyanate. InChIKey: BXJQWEZDUJFARY-UHFFFAOYSA-N.
| Molecular formula | C7H3FN2O2S |
|---|---|
| Molecular weight | 198.18 g/mol |
| IUPAC name | (4-fluoro-2-nitrophenyl) thiocyanate |
| InChIKey | BXJQWEZDUJFARY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)[N+](=O)[O-])SC#N |
Computed by PubChem (NCBI)