CAS 213271-08-0 is the registry number for H-Nva-pna hbr, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2S)-2-amino-N-(4-nitrophenyl)pentanamide;hydrobromide (CAS 213271-08-0) is a chemical compound with the molecular formula C11H16BrN3O3 and a molecular weight of 318.17 g/mol. IUPAC name: (2S)-2-amino-N-(4-nitrophenyl)pentanamide;hydrobromide. InChIKey: QDHUIHIRFDFVBT-PPHPATTJSA-N.
| Molecular formula | C11H16BrN3O3 |
|---|---|
| Molecular weight | 318.17 g/mol |
| IUPAC name | (2S)-2-amino-N-(4-nitrophenyl)pentanamide;hydrobromide |
| InChIKey | QDHUIHIRFDFVBT-PPHPATTJSA-N |
| SMILES | CCC[C@@H](C(=O)NC1=CC=C(C=C1)[N+](=O)[O-])N.Br |
Computed by PubChem (NCBI)