Products 2133001-88-2
CAS 2133001-88-2 appears in our catalog under these names: Aurora kinase inhibitor–8, Aurora kinase inhibitor-8, 98%, 98%, Aurora kinase inhibitor-8, 98.01%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 10mM/1mL, 25 mg, 10 mg, 5 mg, 100 mg.
4-(propanoylamino)-N-[4-[(5,8,11-trimethyl-6-oxopyrimido[4,5-b][1,4]benzodiazepin-2-yl)amino]phenyl]benzamide (CAS 2133001-88-2) is a chemical compound with the molecular formula C30H29N7O3 and a molecular weight of 535.6 g/mol. IUPAC name: 4-(propanoylamino)-N-[4-[(5,8,11-trimethyl-6-oxopyrimido[4,5-b][1,4]benzodiazepin-2-yl)amino]phenyl]benzamide. InChIKey: KGXBCWANASZZQG-UHFFFAOYSA-N.
| Molecular formula | C30H29N7O3 |
|---|---|
| Molecular weight | 535.6 g/mol |
| IUPAC name | 4-(propanoylamino)-N-[4-[(5,8,11-trimethyl-6-oxopyrimido[4,5-b][1,4]benzodiazepin-2-yl)amino]phenyl]benzamide |
| InChIKey | KGXBCWANASZZQG-UHFFFAOYSA-N |
| SMILES | CCC(=O)NC1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)NC3=NC=C4C(=N3)N(C5=C(C=C(C=C5)C)C(=O)N4C)C |
Computed by PubChem (NCBI)
Synonyms:
Aurora kinase inhibitor-8, orb1686264