CAS 2133010-38-3 is the registry number for SMW139. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide (CAS 2133010-38-3) is a chemical compound with the molecular formula C19H21ClF3NO2 and a molecular weight of 387.8 g/mol. IUPAC name: 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide. InChIKey: DWSQAAMUNCFYTG-UHFFFAOYSA-N.
| Molecular formula | C19H21ClF3NO2 |
|---|---|
| Molecular weight | 387.8 g/mol |
| IUPAC name | 2-chloro-5-methoxy-N-[(3,5,7-trifluoro-1-adamantyl)methyl]benzamide |
| InChIKey | DWSQAAMUNCFYTG-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)Cl)C(=O)NCC23CC4(CC(C2)(CC(C3)(C4)F)F)F |
Computed by PubChem (NCBI)