CAS 2133017-36-2 appears in our catalog under these names: GLP-26, 98%, GLP-26/ 95.84% (existing batch purity), GLP–26, GLP-26, GLP-26, 98.36%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 200mg, 10mM (in 1ml dmso).
N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(prop-2-ynylamino)acetyl]pyrrole-2-carboxamide (CAS 2133017-36-2) is a chemical compound with the molecular formula C19H17F2N3O3 and a molecular weight of 373.4 g/mol. IUPAC name: N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(prop-2-ynylamino)acetyl]pyrrole-2-carboxamide. InChIKey: SQOFSIXYJGPNKV-UHFFFAOYSA-N.
| Molecular formula | C19H17F2N3O3 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | N-(3,4-difluorophenyl)-1,3,5-trimethyl-4-[2-oxo-2-(prop-2-ynylamino)acetyl]pyrrole-2-carboxamide |
| InChIKey | SQOFSIXYJGPNKV-UHFFFAOYSA-N |
| SMILES | CC1=C(N(C(=C1C(=O)C(=O)NCC#C)C)C)C(=O)NC2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)