CAS 2133407-73-3 is the registry number for (4-Chloro-3-(4-ethoxybenzyl)phenyl)trimethylsilane. Offered by: TRC. Available pack sizes: 250mg, 5mg.
[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-trimethylsilane (CAS 2133407-73-3) is a chemical compound with the molecular formula C18H23ClOSi and a molecular weight of 318.9 g/mol. IUPAC name: [4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-trimethylsilane. InChIKey: IIRJSUVDKAZXQU-UHFFFAOYSA-N.
| Molecular formula | C18H23ClOSi |
|---|---|
| Molecular weight | 318.9 g/mol |
| IUPAC name | [4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-trimethylsilane |
| InChIKey | IIRJSUVDKAZXQU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)CC2=C(C=CC(=C2)[Si](C)(C)C)Cl |
Computed by PubChem (NCBI)