CAS 2133476-49-8 is the registry number for 2–((Difluoromethyl)sulfinyl)–1,4–dimethylbenzene. Offered by: GLPBio. Available pack sizes: 1g, 200mg.
2-(difluoromethylsulfinyl)-1,4-dimethylbenzene (CAS 2133476-49-8) is a chemical compound with the molecular formula C9H10F2OS and a molecular weight of 204.24 g/mol. IUPAC name: 2-(difluoromethylsulfinyl)-1,4-dimethylbenzene. InChIKey: KDCKQCNDHDKFJL-UHFFFAOYSA-N.
| Molecular formula | C9H10F2OS |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | 2-(difluoromethylsulfinyl)-1,4-dimethylbenzene |
| InChIKey | KDCKQCNDHDKFJL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)C(F)F |
Computed by PubChem (NCBI)