CAS 213381-47-6 is the registry number for 7-Chloro-2-cyclohexyl-2,3-dihydro-1H-inden-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2-cyclohexyl-2,3-dihydroinden-1-one (CAS 213381-47-6) is a chemical compound with the molecular formula C15H17ClO and a molecular weight of 248.75 g/mol. IUPAC name: 7-chloro-2-cyclohexyl-2,3-dihydroinden-1-one. InChIKey: QQKVDOCNNWUFIQ-UHFFFAOYSA-N.
| Molecular formula | C15H17ClO |
|---|---|
| Molecular weight | 248.75 g/mol |
| IUPAC name | 7-chloro-2-cyclohexyl-2,3-dihydroinden-1-one |
| InChIKey | QQKVDOCNNWUFIQ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2CC3=C(C2=O)C(=CC=C3)Cl |
Computed by PubChem (NCBI)