CAS 213388-71-7 is the registry number for tert-Butyl ((3R,4R)-4-fluoropyrrolidin-3-yl)carbamate, 95+%, 95+%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl N-[(3R,4R)-4-fluoropyrrolidin-3-yl]carbamate (CAS 213388-71-7) is a chemical compound with the molecular formula C9H17FN2O2 and a molecular weight of 204.24 g/mol. IUPAC name: tert-butyl N-[(3R,4R)-4-fluoropyrrolidin-3-yl]carbamate. InChIKey: BZSDDSIFAGBZLT-RNFRBKRXSA-N.
| Molecular formula | C9H17FN2O2 |
|---|---|
| Molecular weight | 204.24 g/mol |
| IUPAC name | tert-butyl N-[(3R,4R)-4-fluoropyrrolidin-3-yl]carbamate |
| InChIKey | BZSDDSIFAGBZLT-RNFRBKRXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CNC[C@H]1F |
Computed by PubChem (NCBI)