CAS 2134-24-9 appears in our catalog under these names: N-Benzoyl-dl-phenylalanine 2-naphthyl ester, 95%, Bz-DL-Phe-beta-naphthyl ester. Offered by: Combi-blocks, Creative Peptides. Available pack sizes: 5g, 1g.
Naphthalen-2-yl 2-benzamido-3-phenylpropanoate (CAS 2134-24-9) is a chemical compound with the molecular formula C26H21NO3 and a molecular weight of 395.4 g/mol. IUPAC name: naphthalen-2-yl 2-benzamido-3-phenylpropanoate. InChIKey: NPPKNSHRAVHLHD-UHFFFAOYSA-N.
| Molecular formula | C26H21NO3 |
|---|---|
| Molecular weight | 395.4 g/mol |
| IUPAC name | naphthalen-2-yl 2-benzamido-3-phenylpropanoate |
| InChIKey | NPPKNSHRAVHLHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C(=O)OC2=CC3=CC=CC=C3C=C2)NC(=O)C4=CC=CC=C4 |
Computed by PubChem (NCBI)