CAS 213406-25-8 is the registry number for (R)-2-(o-Tolyl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-2-(2-methylphenyl)propanoic acid (CAS 213406-25-8) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (2R)-2-(2-methylphenyl)propanoic acid. InChIKey: MQHULLOCAJMXJU-MRVPVSSYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (2R)-2-(2-methylphenyl)propanoic acid |
| InChIKey | MQHULLOCAJMXJU-MRVPVSSYSA-N |
| SMILES | CC1=CC=CC=C1[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)