CAS 213406-28-1 appears in our catalog under these names: (R)-2-M-Tolyl-propionic acid, 95%, (R)–2–m–Tolyl–propionic acid, (R)-2-m-Tolyl-propionic acid ee, (R)-2-m-Tolyl-propionic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 2,5g.
(2R)-2-(3-methylphenyl)propanoic acid (CAS 213406-28-1) is a chemical compound with the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. IUPAC name: (2R)-2-(3-methylphenyl)propanoic acid. InChIKey: ZUWBVWNCAANKGU-MRVPVSSYSA-N.
| Molecular formula | C10H12O2 |
|---|---|
| Molecular weight | 164.20 g/mol |
| IUPAC name | (2R)-2-(3-methylphenyl)propanoic acid |
| InChIKey | ZUWBVWNCAANKGU-MRVPVSSYSA-N |
| SMILES | CC1=CC(=CC=C1)[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)