CAS 213413-30-0 is the registry number for trans-4-((((1,1-Dimethylethyl)dimethylsilyl)oxy)methyl)cyclohexanecarboxaldehyde. Offered by: TRC. Available pack sizes: 1g.
4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde (CAS 213413-30-0) is a chemical compound with the molecular formula C14H28O2Si and a molecular weight of 256.46 g/mol. IUPAC name: 4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde. InChIKey: WXRKOUOCMREXLF-UHFFFAOYSA-N.
| Molecular formula | C14H28O2Si |
|---|---|
| Molecular weight | 256.46 g/mol |
| IUPAC name | 4-[[tert-butyl(dimethyl)silyl]oxymethyl]cyclohexane-1-carbaldehyde |
| InChIKey | WXRKOUOCMREXLF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCC(CC1)C=O |
Computed by PubChem (NCBI)