CAS 21344-81-0 is the registry number for N-Benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
N-benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine (CAS 21344-81-0) is a chemical compound with the molecular formula C16H13ClN2S and a molecular weight of 300.8 g/mol. IUPAC name: N-benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine. InChIKey: QQDAIBUEPKCZLS-UHFFFAOYSA-N.
| Molecular formula | C16H13ClN2S |
|---|---|
| Molecular weight | 300.8 g/mol |
| IUPAC name | N-benzyl-4-(4-chlorophenyl)-1,3-thiazol-2-amine |
| InChIKey | QQDAIBUEPKCZLS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=NC(=CS2)C3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)