CAS 213453-08-8 appears in our catalog under these names: 2-(2-Bromoisobutyryloxy)ethyl methacrylate, 95%, 2–(2–Bromoisobutyryloxy)ethyl methacrylate(stabilized with TBC), 2-[(2-Bromo-2-methylpropanoyl)oxy]ethyl Methacrylate, >95.0%(GC), 2-(2-BROMOISOBUTYRYLOXY)ETHYL METHACRYL&, 2-((2-Bromo-2-methylpropanoyl)oxy)ethyl methacrylate, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Sigma-Aldrich, Chemat. Available pack sizes: 1g, 5g, 25g, 250mg, 100g.
2-(2-methylprop-2-enoyloxy)ethyl 2-bromo-2-methylpropanoate (CAS 213453-08-8) is a chemical compound with the molecular formula C10H15BrO4 and a molecular weight of 279.13 g/mol. IUPAC name: 2-(2-methylprop-2-enoyloxy)ethyl 2-bromo-2-methylpropanoate. InChIKey: QXDYJUSFCUKOQD-UHFFFAOYSA-N.
| Molecular formula | C10H15BrO4 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 2-(2-methylprop-2-enoyloxy)ethyl 2-bromo-2-methylpropanoate |
| InChIKey | QXDYJUSFCUKOQD-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCOC(=O)C(C)(C)Br |
Computed by PubChem (NCBI)