CAS 213455-11-9 is the registry number for 5-((4-(Benzyloxy)benzo[b]thiophen-7-yl)methyl)thiazolidine-2,4-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-[(4-phenylmethoxy-1-benzothiophen-7-yl)methyl]-1,3-thiazolidine-2,4-dione (CAS 213455-11-9) is a chemical compound with the molecular formula C19H15NO3S2 and a molecular weight of 369.5 g/mol. IUPAC name: 5-[(4-phenylmethoxy-1-benzothiophen-7-yl)methyl]-1,3-thiazolidine-2,4-dione. InChIKey: NUZJKSMUMCMIJF-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3S2 |
|---|---|
| Molecular weight | 369.5 g/mol |
| IUPAC name | 5-[(4-phenylmethoxy-1-benzothiophen-7-yl)methyl]-1,3-thiazolidine-2,4-dione |
| InChIKey | NUZJKSMUMCMIJF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=C3C=CSC3=C(C=C2)CC4C(=O)NC(=O)S4 |
Computed by PubChem (NCBI)