CAS 21348-59-4 appears in our catalog under these names: Niobium(V) oxalate hydrate, 95%, Niobium(V) oxalate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 100g, 500g, 25g, 5g.
Niobium(2+);oxalate (CAS 21348-59-4) is a chemical compound with the molecular formula C2NbO4 and a molecular weight of 180.93 g/mol. IUPAC name: niobium(2+);oxalate. InChIKey: NAIRZPRKOQHYBO-UHFFFAOYSA-L.
| Molecular formula | C2NbO4 |
|---|---|
| Molecular weight | 180.93 g/mol |
| IUPAC name | niobium(2+);oxalate |
| InChIKey | NAIRZPRKOQHYBO-UHFFFAOYSA-L |
| SMILES | C(=O)(C(=O)[O-])[O-].[Nb+2] |
Computed by PubChem (NCBI)