CAS 21352-09-0 is the registry number for 2-Chloro-6-methylacetanilin. Offered by: TRC. Available pack sizes: 100mg.
N-(2-chloro-6-methylphenyl)acetamide (CAS 21352-09-0) is a chemical compound with the molecular formula C9H10ClNO and a molecular weight of 183.63 g/mol. IUPAC name: N-(2-chloro-6-methylphenyl)acetamide. InChIKey: VFGNPYWQUOSOSR-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO |
|---|---|
| Molecular weight | 183.63 g/mol |
| IUPAC name | N-(2-chloro-6-methylphenyl)acetamide |
| InChIKey | VFGNPYWQUOSOSR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)Cl)NC(=O)C |
Computed by PubChem (NCBI)