CAS 2135309-56-5 appears in our catalog under these names: IDH1 Inhibitor 7, IDH1 Inhibitor 7, 99%, 99%, IDH1 Inhibitor 7, 99.46%. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 1mg, 5mg, 25 mg, 10 mg, 5 mg.
(5S)-5-propan-2-yl-1-[2-[[(1S)-1-[1-[4-(trifluoromethyl)phenyl]imidazol-4-yl]ethyl]amino]pyrimidin-4-yl]imidazolidin-2-one (CAS 2135309-56-5) is a chemical compound with the molecular formula C22H24F3N7O and a molecular weight of 459.5 g/mol. IUPAC name: (5S)-5-propan-2-yl-1-[2-[[(1S)-1-[1-[4-(trifluoromethyl)phenyl]imidazol-4-yl]ethyl]amino]pyrimidin-4-yl]imidazolidin-2-one. InChIKey: LVRDYDOHWFEBQG-KBXCAEBGSA-N.
| Molecular formula | C22H24F3N7O |
|---|---|
| Molecular weight | 459.5 g/mol |
| IUPAC name | (5S)-5-propan-2-yl-1-[2-[[(1S)-1-[1-[4-(trifluoromethyl)phenyl]imidazol-4-yl]ethyl]amino]pyrimidin-4-yl]imidazolidin-2-one |
| InChIKey | LVRDYDOHWFEBQG-KBXCAEBGSA-N |
| SMILES | C[C@@H](C1=CN(C=N1)C2=CC=C(C=C2)C(F)(F)F)NC3=NC=CC(=N3)N4[C@H](CNC4=O)C(C)C |
Computed by PubChem (NCBI)