CAS 21354-40-5 appears in our catalog under these names: N-(4-methylphenyl)-2,2-dimethylpropanamide, 98%, 98%, N-(p-Tolyl)pivalamide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,2-dimethyl-N-(4-methylphenyl)propanamide (CAS 21354-40-5) is a chemical compound with the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. IUPAC name: 2,2-dimethyl-N-(4-methylphenyl)propanamide. InChIKey: AJDJGYGXHCQGSM-UHFFFAOYSA-N.
| Molecular formula | C12H17NO |
|---|---|
| Molecular weight | 191.27 g/mol |
| IUPAC name | 2,2-dimethyl-N-(4-methylphenyl)propanamide |
| InChIKey | AJDJGYGXHCQGSM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)NC(=O)C(C)(C)C |
Computed by PubChem (NCBI)