CAS 2135511-82-7 is the registry number for 4-(Trifluoromethoxy)benzene-1-sulfonyl isocyanate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
N-(oxomethylidene)-4-(trifluoromethoxy)benzenesulfonamide (CAS 2135511-82-7) is a chemical compound with the molecular formula C8H4F3NO4S and a molecular weight of 267.18 g/mol. IUPAC name: N-(oxomethylidene)-4-(trifluoromethoxy)benzenesulfonamide. InChIKey: RKTPKWAYMHIIPJ-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO4S |
|---|---|
| Molecular weight | 267.18 g/mol |
| IUPAC name | N-(oxomethylidene)-4-(trifluoromethoxy)benzenesulfonamide |
| InChIKey | RKTPKWAYMHIIPJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OC(F)(F)F)S(=O)(=O)N=C=O |
Computed by PubChem (NCBI)