CAS 2135529-64-3 is the registry number for Potassium 4-diphenylamino-phenyltrifluoroborate, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
Potassium trifluoro-[4-(N-phenylanilino)phenyl]boranuide (CAS 2135529-64-3) is a chemical compound with the molecular formula C18H14BF3KN and a molecular weight of 351.2 g/mol. IUPAC name: potassium trifluoro-[4-(N-phenylanilino)phenyl]boranuide. InChIKey: LVLFZQHJZORNMT-UHFFFAOYSA-N.
| Molecular formula | C18H14BF3KN |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | potassium trifluoro-[4-(N-phenylanilino)phenyl]boranuide |
| InChIKey | LVLFZQHJZORNMT-UHFFFAOYSA-N |
| SMILES | [B-](C1=CC=C(C=C1)N(C2=CC=CC=C2)C3=CC=CC=C3)(F)(F)F.[K+] |
Computed by PubChem (NCBI)