CAS 2135538-89-3 is the registry number for 4,4',4''-(1H-Imidazole-2,4,5-triyl)tribenzonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[2,4-bis(4-cyanophenyl)-1H-imidazol-5-yl]benzonitrile (CAS 2135538-89-3) is a chemical compound with the molecular formula C24H13N5 and a molecular weight of 371.4 g/mol. IUPAC name: 4-[2,4-bis(4-cyanophenyl)-1H-imidazol-5-yl]benzonitrile. InChIKey: FSDAWIZFGAEUPE-UHFFFAOYSA-N.
| Molecular formula | C24H13N5 |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 4-[2,4-bis(4-cyanophenyl)-1H-imidazol-5-yl]benzonitrile |
| InChIKey | FSDAWIZFGAEUPE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C#N)C2=C(N=C(N2)C3=CC=C(C=C3)C#N)C4=CC=C(C=C4)C#N |
Computed by PubChem (NCBI)