Products 2135702-41-7

CAS 2135702-41-7 is the registry number for 2,5-Diazaspiro[3.4]octan-6-one bis(4-methylbenzenesulfonate), 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.

Structural formula: {0} (CAS {1})

2,5-diazaspiro[3.4]octan-6-one;bis(4-methylbenzenesulfonic acid) (CAS 2135702-41-7) is a chemical compound with the molecular formula C20H26N2O7S2 and a molecular weight of 470.6 g/mol. IUPAC name: 2,5-diazaspiro[3.4]octan-6-one;bis(4-methylbenzenesulfonic acid). InChIKey: BHZALKBPLSCSCA-UHFFFAOYSA-N.

Identity
Molecular formulaC20H26N2O7S2
Molecular weight470.6 g/mol
IUPAC name2,5-diazaspiro[3.4]octan-6-one;bis(4-methylbenzenesulfonic acid)
InChIKeyBHZALKBPLSCSCA-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)O.CC1=CC=C(C=C1)S(=O)(=O)O.C1CC2(CNC2)NC1=O

Computed by PubChem (NCBI)