CAS 21358-23-6 is the registry number for 3-((4-Chloro-2-methylphenoxy)methyl)-4-phenyl-1,2,4-triazoline-5-thione. Offered by: Biosynth. Available pack sizes: 5000mg.
3-[(4-chloro-2-methylphenoxy)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione (CAS 21358-23-6) is a chemical compound with the molecular formula C16H14ClN3OS and a molecular weight of 331.8 g/mol. IUPAC name: 3-[(4-chloro-2-methylphenoxy)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione. InChIKey: JEURIIQPMNMJGR-UHFFFAOYSA-N.
| Molecular formula | C16H14ClN3OS |
|---|---|
| Molecular weight | 331.8 g/mol |
| IUPAC name | 3-[(4-chloro-2-methylphenoxy)methyl]-4-phenyl-1H-1,2,4-triazole-5-thione |
| InChIKey | JEURIIQPMNMJGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)Cl)OCC2=NNC(=S)N2C3=CC=CC=C3 |
Computed by PubChem (NCBI)