CAS 213591-88-9 appears in our catalog under these names: Sodium methanesulfonylmethanesulfinate, 95%, Sodium methanesulfonylmethanesulfinate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
Sodium methylsulfonylmethanesulfinate (CAS 213591-88-9) is a chemical compound with the molecular formula C2H5NaO4S2 and a molecular weight of 180.18 g/mol. IUPAC name: sodium methylsulfonylmethanesulfinate. InChIKey: YOTIASMSTOWNJH-UHFFFAOYSA-M.
| Molecular formula | C2H5NaO4S2 |
|---|---|
| Molecular weight | 180.18 g/mol |
| IUPAC name | sodium methylsulfonylmethanesulfinate |
| InChIKey | YOTIASMSTOWNJH-UHFFFAOYSA-M |
| SMILES | CS(=O)(=O)CS(=O)[O-].[Na+] |
Computed by PubChem (NCBI)