CAS 2136246-72-3 appears in our catalog under these names: MD-222, 99%, MD–222, MD-222, 99.28%, 99.28%, MD-222, 98.03%. Offered by: AmBeed, GLPBio, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 10mg, 1mg, 10 mg, 25 mg, 5 mg, 1 mg.
CAS 2136246-72-3 identifies a chemical compound with the molecular formula C48H47Cl2FN6O6 and a molecular weight of 893.8 g/mol. InChIKey: RRSNDVCODIMOFX-MPKOGUQCSA-N.
| Molecular formula | C48H47Cl2FN6O6 |
|---|---|
| Molecular weight | 893.8 g/mol |
| InChIKey | RRSNDVCODIMOFX-MPKOGUQCSA-N |
| SMILES | C1CCC2(CC1)[C@@]3([C@H]([C@@H](N2)C(=O)NC4=CC=C(C=C4)C(=O)NCCCCCC5=C6CN(C(=O)C6=CC=C5)C7CCC(=O)NC7=O)C8=C(C(=CC=C8)Cl)F)C9=C(C=C(C=C9)Cl)NC3=O |
Computed by PubChem (NCBI)