Products 2136867-31-5
CAS 2136867-31-5 is the registry number for (R)-1-((Benzyloxy)Carbonyl)-4,4-Difluoropyrrolidine-2-Carboxylic Acid, 97%. Offered by: Chemat. Available pack sizes: 500mg, 1g.
(2R)-4,4-difluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid (CAS 2136867-31-5) is a chemical compound with the molecular formula C13H13F2NO4 and a molecular weight of 285.24 g/mol. IUPAC name: (2R)-4,4-difluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid. InChIKey: ICXGOKDOIFGMDR-SNVBAGLBSA-N.
| Molecular formula | C13H13F2NO4 |
|---|---|
| Molecular weight | 285.24 g/mol |
| IUPAC name | (2R)-4,4-difluoro-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid |
| InChIKey | ICXGOKDOIFGMDR-SNVBAGLBSA-N |
| SMILES | C1[C@@H](N(CC1(F)F)C(=O)OCC2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)