Products 21370-71-8
CAS 21370-71-8 appears in our catalog under these names: Trans-1-decalone, 95%, trans-1-Decalone, TRANS-1-DECALONE, 98%. Offered by: Combi-blocks, TRC, Sigma-Aldrich. Available pack sizes: 1g.
(4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one (CAS 21370-71-8) is a chemical compound with the molecular formula C10H16O and a molecular weight of 152.23 g/mol. IUPAC name: (4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one. InChIKey: AFEFRXAPJRCTOW-BDAKNGLRSA-N.
| Molecular formula | C10H16O |
|---|---|
| Molecular weight | 152.23 g/mol |
| IUPAC name | (4aR,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-naphthalen-1-one |
| InChIKey | AFEFRXAPJRCTOW-BDAKNGLRSA-N |
| SMILES | C1CC[C@H]2[C@H](C1)CCCC2=O |
Computed by PubChem (NCBI)