Products 2137062-82-7
CAS 2137062-82-7 appears in our catalog under these names: N-((trans-3-Bromocyclobutyl)methyl)pivalamide, 95%, 2,2-dimethyl-N-{[(1r,3r)-3-bromocyclobutyl]methyl}propanamide, 95%, 95%. Offered by: Chemat Brand, Chemat, Fluorochem. Available pack sizes: on request, 100mg, 250mg, 1g.
N-[(3-bromocyclobutyl)methyl]-2,2-dimethylpropanamide (CAS 2137062-82-7) is a chemical compound with the molecular formula C10H18BrNO and a molecular weight of 248.16 g/mol. IUPAC name: N-[(3-bromocyclobutyl)methyl]-2,2-dimethylpropanamide. InChIKey: JOSQRBIKIMRJNN-UHFFFAOYSA-N.
| Molecular formula | C10H18BrNO |
|---|---|
| Molecular weight | 248.16 g/mol |
| IUPAC name | N-[(3-bromocyclobutyl)methyl]-2,2-dimethylpropanamide |
| InChIKey | JOSQRBIKIMRJNN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)NCC1CC(C1)Br |
Computed by PubChem (NCBI)