Products 2137434-28-5
CAS 2137434-28-5 is the registry number for rac-tert-Butyl (3R,4S)-3-amino-4-(1H-1,2,3-triazol-1-yl)cyclopentane-1-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Cis-tert-butyl (3R,4S)-3-amino-4-(triazol-1-yl)cyclopentane-1-carboxylate (CAS 2137434-28-5) is a chemical compound with the molecular formula C12H20N4O2 and a molecular weight of 252.31 g/mol. IUPAC name: cis-tert-butyl (3R,4S)-3-amino-4-(triazol-1-yl)cyclopentane-1-carboxylate. InChIKey: UIIHLQIYHBLSOW-XVBQNVSMSA-N.
| Molecular formula | C12H20N4O2 |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | cis-tert-butyl (3R,4S)-3-amino-4-(triazol-1-yl)cyclopentane-1-carboxylate |
| InChIKey | UIIHLQIYHBLSOW-XVBQNVSMSA-N |
| SMILES | CC(C)(C)OC(=O)C1C[C@H]([C@H](C1)N2C=CN=N2)N |
Computed by PubChem (NCBI)