Products 2137451-60-4
CAS 2137451-60-4 is the registry number for Fmoc-Pro(3,3-F2)-OH (RS). Offered by: Iris Biotech. Available pack sizes: 1g.
1-(9H-fluoren-9-ylmethoxycarbonyl)-3,3-difluoropyrrolidine-2-carboxylic acid (CAS 2137451-60-4) is a chemical compound with the molecular formula C20H17F2NO4 and a molecular weight of 373.3 g/mol. IUPAC name: 1-(9H-fluoren-9-ylmethoxycarbonyl)-3,3-difluoropyrrolidine-2-carboxylic acid. InChIKey: VHXZNQGGLTZVQI-UHFFFAOYSA-N.
| Molecular formula | C20H17F2NO4 |
|---|---|
| Molecular weight | 373.3 g/mol |
| IUPAC name | 1-(9H-fluoren-9-ylmethoxycarbonyl)-3,3-difluoropyrrolidine-2-carboxylic acid |
| InChIKey | VHXZNQGGLTZVQI-UHFFFAOYSA-N |
| SMILES | C1CN(C(C1(F)F)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)