CAS 2137463-04-6 is the registry number for 2-Amino-4-(1H-1,2,3,4-tetrazol-5-yl)butanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-amino-4-(2H-tetrazol-5-yl)butanoic acid;hydrochloride (CAS 2137463-04-6) is a chemical compound with the molecular formula C5H10ClN5O2 and a molecular weight of 207.62 g/mol. IUPAC name: 2-amino-4-(2H-tetrazol-5-yl)butanoic acid;hydrochloride. InChIKey: DITKHVFIPFIHAZ-UHFFFAOYSA-N.
| Molecular formula | C5H10ClN5O2 |
|---|---|
| Molecular weight | 207.62 g/mol |
| IUPAC name | 2-amino-4-(2H-tetrazol-5-yl)butanoic acid;hydrochloride |
| InChIKey | DITKHVFIPFIHAZ-UHFFFAOYSA-N |
| SMILES | C(CC(C(=O)O)N)C1=NNN=N1.Cl |
Computed by PubChem (NCBI)