Products 2137481-21-9

CAS 2137481-21-9 is the registry number for Methyl 2-amino-2-(5-bromothiophen-3-yl)acetate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-2-(5-bromothiophen-3-yl)acetate;hydrochloride (CAS 2137481-21-9) is a chemical compound with the molecular formula C7H9BrClNO2S and a molecular weight of 286.57 g/mol. IUPAC name: methyl 2-amino-2-(5-bromothiophen-3-yl)acetate;hydrochloride. InChIKey: CSJSZKJHKIJQIQ-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9BrClNO2S
Molecular weight286.57 g/mol
IUPAC namemethyl 2-amino-2-(5-bromothiophen-3-yl)acetate;hydrochloride
InChIKeyCSJSZKJHKIJQIQ-UHFFFAOYSA-N
SMILESCOC(=O)C(C1=CSC(=C1)Br)N.Cl

Computed by PubChem (NCBI)