CAS 2137518-72-8 is the registry number for tert-butyl N-{(3-(bromomethyl)bicyclo(1.1.1)pentan-1-yl)methyl}carbamate, 98%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl N-[[3-(bromomethyl)-1-bicyclo[1.1.1]pentanyl]methyl]carbamate (CAS 2137518-72-8) is a chemical compound with the molecular formula C12H20BrNO2 and a molecular weight of 290.20 g/mol. IUPAC name: tert-butyl N-[[3-(bromomethyl)-1-bicyclo[1.1.1]pentanyl]methyl]carbamate. InChIKey: CUIQTXBNBVRFKY-UHFFFAOYSA-N.
| Molecular formula | C12H20BrNO2 |
|---|---|
| Molecular weight | 290.20 g/mol |
| IUPAC name | tert-butyl N-[[3-(bromomethyl)-1-bicyclo[1.1.1]pentanyl]methyl]carbamate |
| InChIKey | CUIQTXBNBVRFKY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC12CC(C1)(C2)CBr |
Computed by PubChem (NCBI)