CAS 2137564-05-5 is the registry number for Sodium 1-((benzyloxy)carbonyl)pyrrolidine-3-sulfinate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Sodium 1-phenylmethoxycarbonylpyrrolidine-3-sulfinate (CAS 2137564-05-5) is a chemical compound with the molecular formula C12H14NNaO4S and a molecular weight of 291.30 g/mol. IUPAC name: sodium 1-phenylmethoxycarbonylpyrrolidine-3-sulfinate. InChIKey: MGBUEUCXPYEEDT-UHFFFAOYSA-M.
| Molecular formula | C12H14NNaO4S |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | sodium 1-phenylmethoxycarbonylpyrrolidine-3-sulfinate |
| InChIKey | MGBUEUCXPYEEDT-UHFFFAOYSA-M |
| SMILES | C1CN(CC1S(=O)[O-])C(=O)OCC2=CC=CC=C2.[Na+] |
Computed by PubChem (NCBI)