CAS 2137578-47-1 appears in our catalog under these names: 1-Benzofuran-3-sulfonyl fluoride, Benzofuran-3-sulfonyl fluoride, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
1-benzofuran-3-sulfonyl fluoride (CAS 2137578-47-1) is a chemical compound with the molecular formula C8H5FO3S and a molecular weight of 200.19 g/mol. IUPAC name: 1-benzofuran-3-sulfonyl fluoride. InChIKey: KSMQIMVYJFHMKN-UHFFFAOYSA-N.
| Molecular formula | C8H5FO3S |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 1-benzofuran-3-sulfonyl fluoride |
| InChIKey | KSMQIMVYJFHMKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CO2)S(=O)(=O)F |
Computed by PubChem (NCBI)