CAS 2137584-91-7 is the registry number for 6,​7-​dihydro-4H-​thiopyrano(4,​3-​d)​thiazol-​2-​amine 5,​5-​dioxide hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Imino-oxo-phenyl-prop-2-enyl-lambda6-sulfane;4-methylbenzenesulfonic acid (CAS 2137584-91-7) is a chemical compound with the molecular formula C16H19NO4S2 and a molecular weight of 353.5 g/mol. IUPAC name: imino-oxo-phenyl-prop-2-enyl-lambda6-sulfane;4-methylbenzenesulfonic acid. InChIKey: PQKWTTQHPFOPTP-UHFFFAOYSA-N.
| Molecular formula | C16H19NO4S2 |
|---|---|
| Molecular weight | 353.5 g/mol |
| IUPAC name | imino-oxo-phenyl-prop-2-enyl-lambda6-sulfane;4-methylbenzenesulfonic acid |
| InChIKey | PQKWTTQHPFOPTP-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C=CCS(=N)(=O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)