CAS 2137593-09-8 is the registry number for 6-(Trifluoromethyl)-2,3-dihydro-1,2-benzothiazole-1,1,3-trione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1,1-dioxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one (CAS 2137593-09-8) is a chemical compound with the molecular formula C8H4F3NO3S and a molecular weight of 251.18 g/mol. IUPAC name: 1,1-dioxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one. InChIKey: TVOMGDRQXXWGBK-UHFFFAOYSA-N.
| Molecular formula | C8H4F3NO3S |
|---|---|
| Molecular weight | 251.18 g/mol |
| IUPAC name | 1,1-dioxo-6-(trifluoromethyl)-1,2-benzothiazol-3-one |
| InChIKey | TVOMGDRQXXWGBK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)S(=O)(=O)NC2=O |
Computed by PubChem (NCBI)