CAS 2137601-21-7 is the registry number for 4-Bromo-1-chloro-6-(trifluoromethyl)isoquinoline, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-bromo-1-chloro-6-(trifluoromethyl)isoquinoline (CAS 2137601-21-7) is a chemical compound with the molecular formula C10H4BrClF3N and a molecular weight of 310.50 g/mol. IUPAC name: 4-bromo-1-chloro-6-(trifluoromethyl)isoquinoline. InChIKey: UKUAVPSJVHGNLZ-UHFFFAOYSA-N.
| Molecular formula | C10H4BrClF3N |
|---|---|
| Molecular weight | 310.50 g/mol |
| IUPAC name | 4-bromo-1-chloro-6-(trifluoromethyl)isoquinoline |
| InChIKey | UKUAVPSJVHGNLZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(F)(F)F)C(=CN=C2Cl)Br |
Computed by PubChem (NCBI)