CAS 2137653-18-8 is the registry number for 1-(Difluoromethyl)-3-nitro-1H-1,2,4-triazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(difluoromethyl)-3-nitro-1,2,4-triazole (CAS 2137653-18-8) is a chemical compound with the molecular formula C3H2F2N4O2 and a molecular weight of 164.07 g/mol. IUPAC name: 1-(difluoromethyl)-3-nitro-1,2,4-triazole. InChIKey: YSBGCZYHAOFRJE-UHFFFAOYSA-N.
| Molecular formula | C3H2F2N4O2 |
|---|---|
| Molecular weight | 164.07 g/mol |
| IUPAC name | 1-(difluoromethyl)-3-nitro-1,2,4-triazole |
| InChIKey | YSBGCZYHAOFRJE-UHFFFAOYSA-N |
| SMILES | C1=NC(=NN1C(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)