Products 2137677-04-2
CAS 2137677-04-2 is the registry number for N,N-Dimethyl-2-(piperidin-4-yl)-1H-imidazole-4-carboxamide dihydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N,N-dimethyl-2-piperidin-4-yl-1H-imidazole-5-carboxamide;dihydrochloride (CAS 2137677-04-2) is a chemical compound with the molecular formula C11H20Cl2N4O and a molecular weight of 295.21 g/mol. IUPAC name: N,N-dimethyl-2-piperidin-4-yl-1H-imidazole-5-carboxamide;dihydrochloride. InChIKey: CQYKHKZKINHABS-UHFFFAOYSA-N.
| Molecular formula | C11H20Cl2N4O |
|---|---|
| Molecular weight | 295.21 g/mol |
| IUPAC name | N,N-dimethyl-2-piperidin-4-yl-1H-imidazole-5-carboxamide;dihydrochloride |
| InChIKey | CQYKHKZKINHABS-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CN=C(N1)C2CCNCC2.Cl.Cl |
Computed by PubChem (NCBI)