Products 2137729-15-6
CAS 2137729-15-6 is the registry number for rac-(1R,2R,6S,7S)-2-Methyl-4-azatricyclo(5.2.1.0,2,6)decan-3-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(1S,2S,6R,7R)-2-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one (CAS 2137729-15-6) is a chemical compound with the molecular formula C10H15NO and a molecular weight of 165.23 g/mol. IUPAC name: (1S,2S,6R,7R)-2-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one. InChIKey: JRMJAZDGMFAQPH-JIOCBJNQSA-N.
| Molecular formula | C10H15NO |
|---|---|
| Molecular weight | 165.23 g/mol |
| IUPAC name | (1S,2S,6R,7R)-2-methyl-4-azatricyclo[5.2.1.02,6]decan-3-one |
| InChIKey | JRMJAZDGMFAQPH-JIOCBJNQSA-N |
| SMILES | C[C@]12[C@H]3CC[C@H](C3)[C@H]1CNC2=O |
Computed by PubChem (NCBI)