CAS 2137761-07-8 is the registry number for 2-(4-{((9H-Fluoren-9-yl)methoxy)carbonyl)-1,1-dioxidothiomorpholin-2-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinan-2-yl]acetic acid (CAS 2137761-07-8) is a chemical compound with the molecular formula C21H21NO6S and a molecular weight of 415.5 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinan-2-yl]acetic acid. InChIKey: LVUXMQFWQRXKER-UHFFFAOYSA-N.
| Molecular formula | C21H21NO6S |
|---|---|
| Molecular weight | 415.5 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonyl)-1,1-dioxo-1,4-thiazinan-2-yl]acetic acid |
| InChIKey | LVUXMQFWQRXKER-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)C(CN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)CC(=O)O |
Computed by PubChem (NCBI)