Products 2137761-21-6
CAS 2137761-21-6 is the registry number for tert-Butyl 3-(methylsulfamoyl)-4H,5H,6H,7H-pyrazolo(1,5-a)pyrazine-5-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Tert-butyl 3-(methylsulfamoyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate (CAS 2137761-21-6) is a chemical compound with the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. IUPAC name: tert-butyl 3-(methylsulfamoyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate. InChIKey: ACARLMXLBFQECW-UHFFFAOYSA-N.
| Molecular formula | C12H20N4O4S |
|---|---|
| Molecular weight | 316.38 g/mol |
| IUPAC name | tert-butyl 3-(methylsulfamoyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-5-carboxylate |
| InChIKey | ACARLMXLBFQECW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=C(C=N2)S(=O)(=O)NC)C1 |
Computed by PubChem (NCBI)