CAS 2137765-85-4 is the registry number for SODIUM (2,4-DICHLOROPHENYL)METHANESULFIN. Offered by: Sigma-Aldrich. Available pack sizes: 500MG.
Sodium (2,4-dichlorophenyl)methanesulfinate (CAS 2137765-85-4) is a chemical compound with the molecular formula C7H5Cl2NaO2S and a molecular weight of 247.07 g/mol. IUPAC name: sodium (2,4-dichlorophenyl)methanesulfinate. InChIKey: QZBRLPYMALKZDY-UHFFFAOYSA-M.
| Molecular formula | C7H5Cl2NaO2S |
|---|---|
| Molecular weight | 247.07 g/mol |
| IUPAC name | sodium (2,4-dichlorophenyl)methanesulfinate |
| InChIKey | QZBRLPYMALKZDY-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CS(=O)[O-].[Na+] |
Computed by PubChem (NCBI)