Products 2137768-14-8
CAS 2137768-14-8 is the registry number for 2-(3-Aminopyrrolidin-1-yl)-6-(propan-2-yl)pyrimidin-4-ol hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-(3-aminopyrrolidin-1-yl)-4-propan-2-yl-1H-pyrimidin-6-one;hydrochloride (CAS 2137768-14-8) is a chemical compound with the molecular formula C11H19ClN4O and a molecular weight of 258.75 g/mol. IUPAC name: 2-(3-aminopyrrolidin-1-yl)-4-propan-2-yl-1H-pyrimidin-6-one;hydrochloride. InChIKey: OWHSNKSBNXMSAT-UHFFFAOYSA-N.
| Molecular formula | C11H19ClN4O |
|---|---|
| Molecular weight | 258.75 g/mol |
| IUPAC name | 2-(3-aminopyrrolidin-1-yl)-4-propan-2-yl-1H-pyrimidin-6-one;hydrochloride |
| InChIKey | OWHSNKSBNXMSAT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=O)NC(=N1)N2CCC(C2)N.Cl |
Computed by PubChem (NCBI)