CAS 2137785-72-7 is the registry number for Potassium 5-(1,2-thiazol-5-yl)-1,3,4-oxadiazole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Potassium 5-(1,2-thiazol-5-yl)-1,3,4-oxadiazole-2-carboxylate (CAS 2137785-72-7) is a chemical compound with the molecular formula C6H2KN3O3S and a molecular weight of 235.26 g/mol. IUPAC name: potassium 5-(1,2-thiazol-5-yl)-1,3,4-oxadiazole-2-carboxylate. InChIKey: DOPGWCYBPLUNRM-UHFFFAOYSA-M.
| Molecular formula | C6H2KN3O3S |
|---|---|
| Molecular weight | 235.26 g/mol |
| IUPAC name | potassium 5-(1,2-thiazol-5-yl)-1,3,4-oxadiazole-2-carboxylate |
| InChIKey | DOPGWCYBPLUNRM-UHFFFAOYSA-M |
| SMILES | C1=C(SN=C1)C2=NN=C(O2)C(=O)[O-].[K+] |
Computed by PubChem (NCBI)