CAS 2137786-65-1 is the registry number for 2,2,2-Trifluoro-1-(oxolan-3-yl)ethyl trifluoromethanesulfonate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
[2,2,2-trifluoro-1-(oxolan-3-yl)ethyl] trifluoromethanesulfonate (CAS 2137786-65-1) is a chemical compound with the molecular formula C7H8F6O4S and a molecular weight of 302.19 g/mol. IUPAC name: [2,2,2-trifluoro-1-(oxolan-3-yl)ethyl] trifluoromethanesulfonate. InChIKey: QUELMKIPWFZXNG-UHFFFAOYSA-N.
| Molecular formula | C7H8F6O4S |
|---|---|
| Molecular weight | 302.19 g/mol |
| IUPAC name | [2,2,2-trifluoro-1-(oxolan-3-yl)ethyl] trifluoromethanesulfonate |
| InChIKey | QUELMKIPWFZXNG-UHFFFAOYSA-N |
| SMILES | C1COCC1C(C(F)(F)F)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)